C14H10F16O7S — CID 87172929
5,5,6,6,7,7,8,8-octafluoro-3-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonyl)-3-sulfooctanoic acid (PubChem CID 87172929) has the molecular formula C14H10F16O7S and a molecular weight of 626.26 g/mol. Its IUPAC name is 5,5,6,6,7,7,8,8-octafluoro-3-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonyl)-3-sulfooctanoic acid.
| Compound Name | 5,5,6,6,7,7,8,8-octafluoro-3-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonyl)-3-sulfooctanoic acid |
|---|---|
| PubChem CID | 87172929 |
| Molecular Formula | C14H10F16O7S |
| Molecular Weight | 626.26 g/mol |
| Exact Mass | 625.99 |
| IUPAC Name | 5,5,6,6,7,7,8,8-octafluoro-3-(2,2,3,3,4,4,5,5-octafluoropentoxycarbonyl)-3-sulfooctanoic acid |
| SMILES | O=C(O)CC(CC(F)(F)C(F)(F)C(F)(F)C(F)F)(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F)S(=O)(=O)O |
| InChI | InChI=1S/C14H10F16O7S/c15-5(16)11(23,24)13(27,28)9(19,20)2-8(1-4(31)32,38(34,35)36)7(33)37-3-10(21,22)14(29,30)12(25,26)6(17)18/h5-6H,1-3H2,(H,31,32)(H,34,35,36) |
| InChIKey | XSHMJQLTKRNABL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.26 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|