C15H13ClF8O2S — CID 133064112
S-[2-chloro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl] benzenecarbothioate (PubChem CID 133064112) has the molecular formula C15H13ClF8O2S and a molecular weight of 444.77 g/mol. Its IUPAC name is S-[2-chloro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl] benzenecarbothioate.
| Compound Name | S-[2-chloro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl] benzenecarbothioate |
|---|---|
| PubChem CID | 133064112 |
| Molecular Formula | C15H13ClF8O2S |
| Molecular Weight | 444.77 g/mol |
| Exact Mass | 444.02 |
| IUPAC Name | S-[2-chloro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propyl] benzenecarbothioate |
| SMILES | O=C(SCC(Cl)COCC(F)(F)C(F)(F)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H13ClF8O2S/c16-10(7-27-11(25)9-4-2-1-3-5-9)6-26-8-13(19,20)15(23,24)14(21,22)12(17)18/h1-5,10,12H,6-8H2 |
| InChIKey | SKYMJQIONTUPNE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.77 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|