C17H13ClF12O2S — CID 133064124
S-[2-chloro-3-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propyl] benzenecarbothioate (PubChem CID 133064124) has the molecular formula C17H13ClF12O2S and a molecular weight of 544.79 g/mol. Its IUPAC name is S-[2-chloro-3-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propyl] benzenecarbothioate.
| Compound Name | S-[2-chloro-3-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propyl] benzenecarbothioate |
|---|---|
| PubChem CID | 133064124 |
| Molecular Formula | C17H13ClF12O2S |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 544.01 |
| IUPAC Name | S-[2-chloro-3-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptoxy)propyl] benzenecarbothioate |
| SMILES | O=C(SCC(Cl)COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1ccccc1 |
| InChI | InChI=1S/C17H13ClF12O2S/c18-10(7-33-11(31)9-4-2-1-3-5-9)6-32-8-13(21,22)15(25,26)17(29,30)16(27,28)14(23,24)12(19)20/h1-5,10,12H,6-8H2 |
| InChIKey | GKAPXGYDGTXSLC-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|