C12H15ClF8O2S — CID 133065084
S-[1-chloro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] butanethioate (PubChem CID 133065084) has the molecular formula C12H15ClF8O2S and a molecular weight of 410.75 g/mol. Its IUPAC name is S-[1-chloro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] butanethioate.
| Compound Name | S-[1-chloro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] butanethioate |
|---|---|
| PubChem CID | 133065084 |
| Molecular Formula | C12H15ClF8O2S |
| Molecular Weight | 410.75 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | S-[1-chloro-3-(2,2,3,3,4,4,5,5-octafluoropentoxy)propan-2-yl] butanethioate |
| SMILES | CCCC(=O)SC(CCl)COCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C12H15ClF8O2S/c1-2-3-8(22)24-7(4-13)5-23-6-10(16,17)12(20,21)11(18,19)9(14)15/h7,9H,2-6H2,1H3 |
| InChIKey | SJUMJCTZCLIMSI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.75 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|