C17H31F4NO6 — CID 162771703
4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-(2,2,3,3-tetrafluoropropoxy)propyl]morpholine (PubChem CID 162771703) has the molecular formula C17H31F4NO6 and a molecular weight of 421.43 g/mol. Its IUPAC name is 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-(2,2,3,3-tetrafluoropropoxy)propyl]morpholine.
| Compound Name | 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-(2,2,3,3-tetrafluoropropoxy)propyl]morpholine |
|---|---|
| PubChem CID | 162771703 |
| Molecular Formula | C17H31F4NO6 |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 4-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]-3-(2,2,3,3-tetrafluoropropoxy)propyl]morpholine |
| SMILES | COCCOCCOCCOC(COCC(F)(F)C(F)F)CN1CCOCC1 |
| InChI | InChI=1S/C17H31F4NO6/c1-23-6-7-25-8-9-26-10-11-28-15(12-22-2-4-24-5-3-22)13-27-14-17(20,21)16(18)19/h15-16H,2-14H2,1H3 |
| InChIKey | JDVUSVMWKPWXAO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|