C15H20F9NO3 — CID 58855461
(4,4,5,5,6,6,7,7,7-nonafluoro-1-morpholin-4-ylheptan-2-yl) butanoate (PubChem CID 58855461) has the molecular formula C15H20F9NO3 and a molecular weight of 433.31 g/mol. Its IUPAC name is (4,4,5,5,6,6,7,7,7-nonafluoro-1-morpholin-4-ylheptan-2-yl) butanoate.
| Compound Name | (4,4,5,5,6,6,7,7,7-nonafluoro-1-morpholin-4-ylheptan-2-yl) butanoate |
|---|---|
| PubChem CID | 58855461 |
| Molecular Formula | C15H20F9NO3 |
| Molecular Weight | 433.31 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | (4,4,5,5,6,6,7,7,7-nonafluoro-1-morpholin-4-ylheptan-2-yl) butanoate |
| SMILES | CCCC(=O)OC(CN1CCOCC1)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H20F9NO3/c1-2-3-11(26)28-10(9-25-4-6-27-7-5-25)8-12(16,17)13(18,19)14(20,21)15(22,23)24/h10H,2-9H2,1H3 |
| InChIKey | RUBMEBJEMFPVIC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|