C28H42F14N2O7 — CID 159618037
4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-ol;[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] acetate (PubChem CID 159618037) has the molecular formula C28H42F14N2O7 and a molecular weight of 784.62 g/mol. Its IUPAC name is 4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-ol;[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] acetate.
| Compound Name | 4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-ol;[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] acetate |
|---|---|
| PubChem CID | 159618037 |
| Molecular Formula | C28H42F14N2O7 |
| Molecular Weight | 784.62 g/mol |
| Exact Mass | 784.28 |
| IUPAC Name | 4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-ol;[4,4,5,5,7,7,7-heptafluoro-1-(2-morpholin-4-ylethoxy)heptan-2-yl] acetate |
| SMILES | CC(=O)OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)CC(F)(F)F.OC(COCCN1CCOCC1)CC(F)(F)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C15H22F7NO4.C13H20F7NO3/c1-11(24)27-12(9-26-7-4-23-2-5-25-6-3-23)8-13(16,17)14(18,19)10-15(20,21)22;14-11(15,12(16,17)9-13(18,19)20)7-10(22)8-24-6-3-21-1-4-23-5-2-21/h12H,2-10H2,1H3;10,22H,1-9H2 |
| InChIKey | MNNNCXPOLUFRKT-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 89.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.62 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|