C11H16F7NO2 — CID 58855373
4,4,6,6,7,7,7-heptafluoro-1-morpholin-4-ylheptan-2-ol (PubChem CID 58855373) has the molecular formula C11H16F7NO2 and a molecular weight of 327.24 g/mol. Its IUPAC name is 4,4,6,6,7,7,7-heptafluoro-1-morpholin-4-ylheptan-2-ol.
| Compound Name | 4,4,6,6,7,7,7-heptafluoro-1-morpholin-4-ylheptan-2-ol |
|---|---|
| PubChem CID | 58855373 |
| Molecular Formula | C11H16F7NO2 |
| Molecular Weight | 327.24 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4,4,6,6,7,7,7-heptafluoro-1-morpholin-4-ylheptan-2-ol |
| SMILES | OC(CN1CCOCC1)CC(F)(F)CC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H16F7NO2/c12-9(13,7-10(14,15)11(16,17)18)5-8(20)6-19-1-3-21-4-2-19/h8,20H,1-7H2 |
| InChIKey | MPRYLIVTFZHPLP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|