C16H18F13NO4 — CID 170053696
(1-acetyloxy-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-(dimethylamino)butanoate (PubChem CID 170053696) has the molecular formula C16H18F13NO4 and a molecular weight of 535.30 g/mol. Its IUPAC name is (1-acetyloxy-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-(dimethylamino)butanoate.
| Compound Name | (1-acetyloxy-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-(dimethylamino)butanoate |
|---|---|
| PubChem CID | 170053696 |
| Molecular Formula | C16H18F13NO4 |
| Molecular Weight | 535.30 g/mol |
| Exact Mass | 535.10 |
| IUPAC Name | (1-acetyloxy-3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl) 4-(dimethylamino)butanoate |
| SMILES | CC(=O)OC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C16H18F13NO4/c1-8(31)33-10(34-9(32)5-4-6-30(2)3)7-11(17,18)12(19,20)13(21,22)14(23,24)15(25,26)16(27,28)29/h10H,4-7H2,1-3H3 |
| InChIKey | QADJHDBQVWTILI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|