C8H4F13NaS — CID 101489240
sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-thiolate (PubChem CID 101489240) has the molecular formula C8H4F13NaS and a molecular weight of 402.15 g/mol. Its IUPAC name is sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-thiolate.
| Compound Name | sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-thiolate |
|---|---|
| PubChem CID | 101489240 |
| Molecular Formula | C8H4F13NaS |
| Molecular Weight | 402.15 g/mol |
| Exact Mass | 401.97 |
| IUPAC Name | sodium 3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctane-1-thiolate |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[S-].[Na+] |
| InChI | InChI=1S/C8H5F13S.Na/c9-3(10,1-2-22)4(11,12)5(13,14)6(15,16)7(17,18)8(19,20)21;/h22H,1-2H2;/q;+1/p-1 |
| InChIKey | ALBLAPIBIMLGEH-UHFFFAOYSA-M |
| XLogP | 1.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.15 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|