C24H16BF36Na — CID 23721151
sodium tetrakis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)boranuide (PubChem CID 23721151) has the molecular formula C24H16BF36Na and a molecular weight of 1022.12 g/mol. Its IUPAC name is sodium tetrakis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)boranuide.
| Compound Name | sodium tetrakis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)boranuide |
|---|---|
| PubChem CID | 23721151 |
| Molecular Formula | C24H16BF36Na |
| Molecular Weight | 1022.12 g/mol |
| Exact Mass | 1022.07 |
| IUPAC Name | sodium tetrakis(3,3,4,4,5,5,6,6,6-nonafluorohexyl)boranuide |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[B-](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na+] |
| InChI | InChI=1S/C24H16BF36.Na/c26-9(27,13(34,35)17(42,43)21(50,51)52)1-5-25(6-2-10(28,29)14(36,37)18(44,45)22(53,54)55,7-3-11(30,31)15(38,39)19(46,47)23(56,57)58)8-4-12(32,33)16(40,41)20(48,49)24(59,60)61;/h1-8H2;/q-1;+1 |
| InChIKey | IYAAIJLCNDGRNV-UHFFFAOYSA-N |
| XLogP | 11.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1022.12 |
| LogP ≤ 5 | 11.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|