C38H27NO7 — CID 54139504
5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]propan-2-yl]phenoxy]-2-(3-methylphenyl)isoindole-1,3-dione (PubChem CID 54139504) has the molecular formula C38H27NO7 and a molecular weight of 609.63 g/mol. Its IUPAC name is 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]propan-2-yl]phenoxy]-2-(3-methylphenyl)isoindole-1,3-dione.
| Compound Name | 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]propan-2-yl]phenoxy]-2-(3-methylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 54139504 |
| Molecular Formula | C38H27NO7 |
| Molecular Weight | 609.63 g/mol |
| Exact Mass | 609.18 |
| IUPAC Name | 5-[4-[2-[4-[(1,3-dioxo-2-benzofuran-5-yl)oxy]phenyl]propan-2-yl]phenoxy]-2-(3-methylphenyl)isoindole-1,3-dione |
| SMILES | Cc1cccc(N2C(=O)c3ccc(Oc4ccc(C(C)(C)c5ccc(Oc6ccc7c(c6)C(=O)OC7=O)cc5)cc4)cc3C2=O)c1 |
| InChI | InChI=1S/C38H27NO7/c1-22-5-4-6-25(19-22)39-34(40)30-17-15-28(20-32(30)35(39)41)44-26-11-7-23(8-12-26)38(2,3)24-9-13-27(14-10-24)45-29-16-18-31-33(21-29)37(43)46-36(31)42/h4-21H,1-3H3 |
| InChIKey | OABXOLCDQUZJLF-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.63 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|