C39H23NO13 — CID 146523444
[4-(3-hydroxy-1-oxo-3H-2-benzofuran-5-carbonyl)oxy-2-[[4-(phenylcarbamoyl)phenyl]methoxycarbonyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 146523444) has the molecular formula C39H23NO13 and a molecular weight of 713.61 g/mol. Its IUPAC name is [4-(3-hydroxy-1-oxo-3H-2-benzofuran-5-carbonyl)oxy-2-[[4-(phenylcarbamoyl)phenyl]methoxycarbonyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-(3-hydroxy-1-oxo-3H-2-benzofuran-5-carbonyl)oxy-2-[[4-(phenylcarbamoyl)phenyl]methoxycarbonyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 146523444 |
| Molecular Formula | C39H23NO13 |
| Molecular Weight | 713.61 g/mol |
| Exact Mass | 713.12 |
| IUPAC Name | [4-(3-hydroxy-1-oxo-3H-2-benzofuran-5-carbonyl)oxy-2-[[4-(phenylcarbamoyl)phenyl]methoxycarbonyl]phenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(Nc1ccccc1)c1ccc(COC(=O)c2cc(OC(=O)c3ccc4c(c3)C(O)OC4=O)ccc2OC(=O)c2ccc3c(c2)C(=O)OC3=O)cc1 |
| InChI | InChI=1S/C39H23NO13/c41-32(40-24-4-2-1-3-5-24)21-8-6-20(7-9-21)19-49-35(44)30-18-25(50-33(42)22-10-13-26-28(16-22)38(47)52-36(26)45)12-15-31(30)51-34(43)23-11-14-27-29(17-23)39(48)53-37(27)46/h1-18,38,47H,19H2,(H,40,41) |
| InChIKey | OBQCQZKIWFCFDV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 197.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|