C29H27NO5 — CID 142724626
4-[4-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]buta-1,3-diynyl]phenyl]iminobutyl prop-2-enoate (PubChem CID 142724626) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is 4-[4-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]buta-1,3-diynyl]phenyl]iminobutyl prop-2-enoate.
| Compound Name | 4-[4-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]buta-1,3-diynyl]phenyl]iminobutyl prop-2-enoate |
|---|---|
| PubChem CID | 142724626 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-[4-[4-[4-(3-prop-2-enoyloxypropoxy)phenyl]buta-1,3-diynyl]phenyl]iminobutyl prop-2-enoate |
| SMILES | C=CC(=O)OCCC/C=N/c1ccc(C#CC#Cc2ccc(OCCCOC(=O)C=C)cc2)cc1 |
| InChI | InChI=1S/C29H27NO5/c1-3-28(31)34-21-8-7-20-30-26-16-12-24(13-17-26)10-5-6-11-25-14-18-27(19-15-25)33-22-9-23-35-29(32)4-2/h3-4,12-20H,1-2,7-9,21-23H2/b30-20+ |
| InChIKey | FGEWFVWAPZJTTQ-TWKHWXDSSA-N |
| XLogP | 4.80 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|