C42H46O10 — CID 139696115
2-[2-[2-[2-phenyl-4-[3-phenyl-4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenoxy]ethoxy]ethoxy]ethyl prop-2-enoate (PubChem CID 139696115) has the molecular formula C42H46O10 and a molecular weight of 710.82 g/mol. Its IUPAC name is 2-[2-[2-[2-phenyl-4-[3-phenyl-4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenoxy]ethoxy]ethoxy]ethyl prop-2-enoate.
| Compound Name | 2-[2-[2-[2-phenyl-4-[3-phenyl-4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 139696115 |
| Molecular Formula | C42H46O10 |
| Molecular Weight | 710.82 g/mol |
| Exact Mass | 710.31 |
| IUPAC Name | 2-[2-[2-[2-phenyl-4-[3-phenyl-4-[2-[2-(2-prop-2-enoyloxyethoxy)ethoxy]ethoxy]phenyl]phenoxy]ethoxy]ethoxy]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCOCCOCCOc1ccc(-c2ccc(OCCOCCOCCOC(=O)C=C)c(-c3ccccc3)c2)cc1-c1ccccc1 |
| InChI | InChI=1S/C42H46O10/c1-3-41(43)51-29-25-47-21-19-45-23-27-49-39-17-15-35(31-37(39)33-11-7-5-8-12-33)36-16-18-40(38(32-36)34-13-9-6-10-14-34)50-28-24-46-20-22-48-26-30-52-42(44)4-2/h3-18,31-32H,1-2,19-30H2 |
| InChIKey | OWKBZEMHMUFGIK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.82 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|