C25H42NO6+ — CID 71128752
3,3-dicarboxypropyl-dimethyl-[2-[2-(4-octylphenoxy)ethoxy]ethyl]azanium (PubChem CID 71128752) has the molecular formula C25H42NO6+ and a molecular weight of 452.61 g/mol. Its IUPAC name is 3,3-dicarboxypropyl-dimethyl-[2-[2-(4-octylphenoxy)ethoxy]ethyl]azanium.
| Compound Name | 3,3-dicarboxypropyl-dimethyl-[2-[2-(4-octylphenoxy)ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 71128752 |
| Molecular Formula | C25H42NO6+ |
| Molecular Weight | 452.61 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 3,3-dicarboxypropyl-dimethyl-[2-[2-(4-octylphenoxy)ethoxy]ethyl]azanium |
| SMILES | CCCCCCCCc1ccc(OCCOCC[N+](C)(C)CCC(C(=O)O)C(=O)O)cc1 |
| InChI | InChI=1S/C25H41NO6/c1-4-5-6-7-8-9-10-21-11-13-22(14-12-21)32-20-19-31-18-17-26(2,3)16-15-23(24(27)28)25(29)30/h11-14,23H,4-10,15-20H2,1-3H3,(H-,27,28,29,30)/p+1 |
| InChIKey | IQRMOWHHICXPJZ-UHFFFAOYSA-O |
| XLogP | 4.24 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|