C22H31ClN2O2 — CID 11406662
1-[5-[3-amino-3-(hydroxymethyl)pentyl]-4-chloro-1-methylpyrrol-2-yl]-5-phenylpentan-1-one (PubChem CID 11406662) has the molecular formula C22H31ClN2O2 and a molecular weight of 390.96 g/mol. Its IUPAC name is 1-[5-[3-amino-3-(hydroxymethyl)pentyl]-4-chloro-1-methylpyrrol-2-yl]-5-phenylpentan-1-one.
| Compound Name | 1-[5-[3-amino-3-(hydroxymethyl)pentyl]-4-chloro-1-methylpyrrol-2-yl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 11406662 |
| Molecular Formula | C22H31ClN2O2 |
| Molecular Weight | 390.96 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-[5-[3-amino-3-(hydroxymethyl)pentyl]-4-chloro-1-methylpyrrol-2-yl]-5-phenylpentan-1-one |
| SMILES | CCC(N)(CO)CCc1c(Cl)cc(C(=O)CCCCc2ccccc2)n1C |
| InChI | InChI=1S/C22H31ClN2O2/c1-3-22(24,16-26)14-13-19-18(23)15-20(25(19)2)21(27)12-8-7-11-17-9-5-4-6-10-17/h4-6,9-10,15,26H,3,7-8,11-14,16,24H2,1-2H3 |
| InChIKey | DYEKOWKSFBHUNP-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.96 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|