C19H21NO5 — CID 174532955
2-[[4-[4-(3-hydroxyphenyl)butoxy]benzoyl]amino]acetic acid (PubChem CID 174532955) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[[4-[4-(3-hydroxyphenyl)butoxy]benzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[4-(3-hydroxyphenyl)butoxy]benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 174532955 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 2-[[4-[4-(3-hydroxyphenyl)butoxy]benzoyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1ccc(OCCCCc2cccc(O)c2)cc1 |
| InChI | InChI=1S/C19H21NO5/c21-16-6-3-5-14(12-16)4-1-2-11-25-17-9-7-15(8-10-17)19(24)20-13-18(22)23/h3,5-10,12,21H,1-2,4,11,13H2,(H,20,24)(H,22,23) |
| InChIKey | WEXUCMRCUDTROT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|