C22H32N4O — CID 86912708
1-[[4-(dimethylamino)phenyl]methyl]-3-[2-(dimethylamino)-3-phenylpropyl]-1-methylurea (PubChem CID 86912708) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-3-[2-(dimethylamino)-3-phenylpropyl]-1-methylurea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[2-(dimethylamino)-3-phenylpropyl]-1-methylurea |
|---|---|
| PubChem CID | 86912708 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-3-[2-(dimethylamino)-3-phenylpropyl]-1-methylurea |
| SMILES | CN(Cc1ccc(N(C)C)cc1)C(=O)NCC(Cc1ccccc1)N(C)C |
| InChI | InChI=1S/C22H32N4O/c1-24(2)20-13-11-19(12-14-20)17-26(5)22(27)23-16-21(25(3)4)15-18-9-7-6-8-10-18/h6-14,21H,15-17H2,1-5H3,(H,23,27) |
| InChIKey | KTTKDPNEXRIACO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|