C20H24F3N3O — CID 78832463
1-[2-(dimethylamino)-3-phenylpropyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea (PubChem CID 78832463) has the molecular formula C20H24F3N3O and a molecular weight of 379.43 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-phenylpropyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea.
| Compound Name | 1-[2-(dimethylamino)-3-phenylpropyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
|---|---|
| PubChem CID | 78832463 |
| Molecular Formula | C20H24F3N3O |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | 1-[2-(dimethylamino)-3-phenylpropyl]-3-[[4-(trifluoromethyl)phenyl]methyl]urea |
| SMILES | CN(C)C(CNC(=O)NCc1ccc(C(F)(F)F)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H24F3N3O/c1-26(2)18(12-15-6-4-3-5-7-15)14-25-19(27)24-13-16-8-10-17(11-9-16)20(21,22)23/h3-11,18H,12-14H2,1-2H3,(H2,24,25,27) |
| InChIKey | IUSUZECLBNBEJK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |