C15H22F3N3O — CID 167893298
1-[2-(dimethylamino)-3-phenylpropyl]-3-(3,3,3-trifluoropropyl)urea (PubChem CID 167893298) has the molecular formula C15H22F3N3O and a molecular weight of 317.36 g/mol. Its IUPAC name is 1-[2-(dimethylamino)-3-phenylpropyl]-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-[2-(dimethylamino)-3-phenylpropyl]-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 167893298 |
| Molecular Formula | C15H22F3N3O |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-[2-(dimethylamino)-3-phenylpropyl]-3-(3,3,3-trifluoropropyl)urea |
| SMILES | CN(C)C(CNC(=O)NCCC(F)(F)F)Cc1ccccc1 |
| InChI | InChI=1S/C15H22F3N3O/c1-21(2)13(10-12-6-4-3-5-7-12)11-20-14(22)19-9-8-15(16,17)18/h3-7,13H,8-11H2,1-2H3,(H2,19,20,22) |
| InChIKey | WNOVAXFFLWKIIK-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |