C23H34N6O2 — CID 135213883
1-[(Z)-3-amino-4-[amino(benzyl)amino]but-3-enyl]-3-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]urea (PubChem CID 135213883) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is 1-[(Z)-3-amino-4-[amino(benzyl)amino]but-3-enyl]-3-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]urea.
| Compound Name | 1-[(Z)-3-amino-4-[amino(benzyl)amino]but-3-enyl]-3-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]urea |
|---|---|
| PubChem CID | 135213883 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | 1-[(Z)-3-amino-4-[amino(benzyl)amino]but-3-enyl]-3-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]urea |
| SMILES | CN(C)C(CNC(=O)NCC/C(N)=C/N(N)Cc1ccccc1)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C23H34N6O2/c1-28(2)21(14-18-8-10-22(30)11-9-18)15-27-23(31)26-13-12-20(24)17-29(25)16-19-6-4-3-5-7-19/h3-11,17,21,30H,12-16,24-25H2,1-2H3,(H2,26,27,31)/b20-17- |
| InChIKey | VSCJNNFDGLPYIM-JZJYNLBNSA-N |
| XLogP | 1.73 |
| TPSA | 119.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|