C25H29N3O3 — CID 142400626
acetylene;3-[[(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]amino]-4-(2-phenylethylamino)cyclobut-3-ene-1,2-dione (PubChem CID 142400626) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is acetylene;3-[[(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]amino]-4-(2-phenylethylamino)cyclobut-3-ene-1,2-dione.
| Compound Name | acetylene;3-[[(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]amino]-4-(2-phenylethylamino)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 142400626 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | acetylene;3-[[(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]amino]-4-(2-phenylethylamino)cyclobut-3-ene-1,2-dione |
| SMILES | C#C.CN(C)[C@H](CNc1c(NCCc2ccccc2)c(=O)c1=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C23H27N3O3.C2H2/c1-26(2)18(14-17-8-10-19(27)11-9-17)15-25-21-20(22(28)23(21)29)24-13-12-16-6-4-3-5-7-16;1-2/h3-11,18,24-25,27H,12-15H2,1-2H3;1-2H/t18-;/m0./s1 |
| InChIKey | TVNYGYSXIXGPRX-FERBBOLQSA-N |
| XLogP | 2.48 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|