C16H28N6O2 — CID 142400571
1-[(Z)-4-amino-3-hydrazinylbut-3-enyl]-3-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]urea (PubChem CID 142400571) has the molecular formula C16H28N6O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 1-[(Z)-4-amino-3-hydrazinylbut-3-enyl]-3-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]urea.
| Compound Name | 1-[(Z)-4-amino-3-hydrazinylbut-3-enyl]-3-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]urea |
|---|---|
| PubChem CID | 142400571 |
| Molecular Formula | C16H28N6O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 1-[(Z)-4-amino-3-hydrazinylbut-3-enyl]-3-[2-(dimethylamino)-3-(4-hydroxyphenyl)propyl]urea |
| SMILES | CN(C)C(CNC(=O)NCC/C(=C/N)NN)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C16H28N6O2/c1-22(2)14(9-12-3-5-15(23)6-4-12)11-20-16(24)19-8-7-13(10-17)21-18/h3-6,10,14,21,23H,7-9,11,17-18H2,1-2H3,(H2,19,20,24)/b13-10- |
| InChIKey | YPHYACMTDUQXAX-RAXLEYEMSA-N |
| XLogP | -0.18 |
| TPSA | 128.67 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|