C21H27FN4O2 — CID 139568894
4-[(2S)-3-(benzylcarbamoylamino)-2-(dimethylamino)propyl]-2-fluoro-N-methylbenzamide (PubChem CID 139568894) has the molecular formula C21H27FN4O2 and a molecular weight of 386.47 g/mol. Its IUPAC name is 4-[(2S)-3-(benzylcarbamoylamino)-2-(dimethylamino)propyl]-2-fluoro-N-methylbenzamide.
| Compound Name | 4-[(2S)-3-(benzylcarbamoylamino)-2-(dimethylamino)propyl]-2-fluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 139568894 |
| Molecular Formula | C21H27FN4O2 |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-[(2S)-3-(benzylcarbamoylamino)-2-(dimethylamino)propyl]-2-fluoro-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(C[C@@H](CNC(=O)NCc2ccccc2)N(C)C)cc1F |
| InChI | InChI=1S/C21H27FN4O2/c1-23-20(27)18-10-9-16(12-19(18)22)11-17(26(2)3)14-25-21(28)24-13-15-7-5-4-6-8-15/h4-10,12,17H,11,13-14H2,1-3H3,(H,23,27)(H2,24,25,28)/t17-/m0/s1 |
| InChIKey | DCHZCYCSWYXIOO-KRWDZBQOSA-N |
| XLogP | 2.16 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |