C24H34N4O — CID 52580759
3-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-methylurea (PubChem CID 52580759) has the molecular formula C24H34N4O and a molecular weight of 394.56 g/mol. Its IUPAC name is 3-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-methylurea.
| Compound Name | 3-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-methylurea |
|---|---|
| PubChem CID | 52580759 |
| Molecular Formula | C24H34N4O |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 3-[(2R)-2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-[[4-(dimethylamino)phenyl]methyl]-1-methylurea |
| SMILES | CC[C@H](CNC(=O)N(C)Cc1ccc(N(C)C)cc1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C24H34N4O/c1-5-22(28-15-14-20-8-6-7-9-21(20)18-28)16-25-24(29)27(4)17-19-10-12-23(13-11-19)26(2)3/h6-13,22H,5,14-18H2,1-4H3,(H,25,29)/t22-/m1/s1 |
| InChIKey | YFMBXUPZVDQXSW-JOCHJYFZSA-N |
| XLogP | 3.73 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|