C27H31N3O3S — CID 46414341
N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 46414341) has the molecular formula C27H31N3O3S and a molecular weight of 477.63 g/mol. Its IUPAC name is N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 46414341 |
| Molecular Formula | C27H31N3O3S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | N-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-3-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | CCC(CNC(=O)c1cccc(S(=O)(=O)N(C)c2ccccc2)c1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C27H31N3O3S/c1-3-24(30-17-16-21-10-7-8-11-23(21)20-30)19-28-27(31)22-12-9-15-26(18-22)34(32,33)29(2)25-13-5-4-6-14-25/h4-15,18,24H,3,16-17,19-20H2,1-2H3,(H,28,31) |
| InChIKey | XEXGDYPVOZTAKY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |