C15H22IN5 — CID 119154970
1,2-dimethyl-3-[(3-methyl-2-pyridinyl)methyl]-1-(1H-pyrrol-2-ylmethyl)guanidine;hydroiodide (PubChem CID 119154970) has the molecular formula C15H22IN5 and a molecular weight of 399.28 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(3-methyl-2-pyridinyl)methyl]-1-(1H-pyrrol-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-3-[(3-methyl-2-pyridinyl)methyl]-1-(1H-pyrrol-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 119154970 |
| Molecular Formula | C15H22IN5 |
| Molecular Weight | 399.28 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 1,2-dimethyl-3-[(3-methyl-2-pyridinyl)methyl]-1-(1H-pyrrol-2-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ncccc1C)N(C)Cc1ccc[nH]1.I |
| InChI | InChI=1S/C15H21N5.HI/c1-12-6-4-9-18-14(12)10-19-15(16-2)20(3)11-13-7-5-8-17-13;/h4-9,17H,10-11H2,1-3H3,(H,16,19);1H |
| InChIKey | HARFTANSVRFPBV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 56.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|