C19H25IN6S — CID 111519500
3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1,2-dimethyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111519500) has the molecular formula C19H25IN6S and a molecular weight of 496.42 g/mol. Its IUPAC name is 3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1,2-dimethyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1,2-dimethyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111519500 |
| Molecular Formula | C19H25IN6S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.09 |
| IUPAC Name | 3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-1,2-dimethyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N\C)N(C)Cc2cnn(-c3ccccc3)c2)s1.I |
| InChI | InChI=1S/C19H24N6S.HI/c1-4-17-11-21-18(26-17)12-22-19(20-2)24(3)13-15-10-23-25(14-15)16-8-6-5-7-9-16;/h5-11,14H,4,12-13H2,1-3H3,(H,20,22);1H |
| InChIKey | ZBCDWVYUXZQJGF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|