C23H31FN4O2 — CID 111282469
3-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111282469) has the molecular formula C23H31FN4O2 and a molecular weight of 414.53 g/mol. Its IUPAC name is 3-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111282469 |
| Molecular Formula | C23H31FN4O2 |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.24 |
| IUPAC Name | 3-[2-(3-fluorophenyl)-2-morpholin-4-ylethyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC(c1cccc(F)c1)N1CCOCC1)N(C)Cc1ccccc1OC |
| InChI | InChI=1S/C23H31FN4O2/c1-25-23(27(2)17-19-7-4-5-10-22(19)29-3)26-16-21(28-11-13-30-14-12-28)18-8-6-9-20(24)15-18/h4-10,15,21H,11-14,16-17H2,1-3H3,(H,25,26) |
| InChIKey | ZEANWHUKLFLESU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|