C21H31IN4OS — CID 111287088
1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111287088) has the molecular formula C21H31IN4OS and a molecular weight of 514.48 g/mol. Its IUPAC name is 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111287088 |
| Molecular Formula | C21H31IN4OS |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 514.13 |
| IUPAC Name | 1,2-dimethyl-1-[(2-methylphenyl)methyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1cccs1)N1CCOCC1)N(C)Cc1ccccc1C.I |
| InChI | InChI=1S/C21H30N4OS.HI/c1-17-7-4-5-8-18(17)16-24(3)21(22-2)23-15-19(20-9-6-14-27-20)25-10-12-26-13-11-25;/h4-9,14,19H,10-13,15-16H2,1-3H3,(H,22,23);1H |
| InChIKey | GVHZMGJADIWWFP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|