C20H29IN4S — CID 110951391
1-benzyl-1,2-dimethyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 110951391) has the molecular formula C20H29IN4S and a molecular weight of 484.45 g/mol. Its IUPAC name is 1-benzyl-1,2-dimethyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-benzyl-1,2-dimethyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110951391 |
| Molecular Formula | C20H29IN4S |
| Molecular Weight | 484.45 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 1-benzyl-1,2-dimethyl-3-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(c1cccs1)N1CCCC1)N(C)Cc1ccccc1.I |
| InChI | InChI=1S/C20H28N4S.HI/c1-21-20(23(2)16-17-9-4-3-5-10-17)22-15-18(19-11-8-14-25-19)24-12-6-7-13-24;/h3-5,8-11,14,18H,6-7,12-13,15-16H2,1-2H3,(H,21,22);1H |
| InChIKey | CPLXXNKGOSLLPX-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.45 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|