C21H29FN4O — CID 111282635
3-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111282635) has the molecular formula C21H29FN4O and a molecular weight of 372.49 g/mol. Its IUPAC name is 3-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 3-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111282635 |
| Molecular Formula | C21H29FN4O |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | 3-[2-(dimethylamino)-2-(4-fluorophenyl)ethyl]-1-[(2-methoxyphenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(/NCC(c1ccc(F)cc1)N(C)C)N(C)Cc1ccccc1OC |
| InChI | InChI=1S/C21H29FN4O/c1-23-21(26(4)15-17-8-6-7-9-20(17)27-5)24-14-19(25(2)3)16-10-12-18(22)13-11-16/h6-13,19H,14-15H2,1-5H3,(H,23,24) |
| InChIKey | WKNHWMWJVFGVQQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|