C22H26F3N3O — CID 99797997
(3S,4R)-1-benzyl-N-[4-(dimethylamino)-2-methylphenyl]-4-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 99797997) has the molecular formula C22H26F3N3O and a molecular weight of 405.46 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-N-[4-(dimethylamino)-2-methylphenyl]-4-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3S,4R)-1-benzyl-N-[4-(dimethylamino)-2-methylphenyl]-4-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 99797997 |
| Molecular Formula | C22H26F3N3O |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | (3S,4R)-1-benzyl-N-[4-(dimethylamino)-2-methylphenyl]-4-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | Cc1cc(N(C)C)ccc1NC(=O)[C@@H]1CN(Cc2ccccc2)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C22H26F3N3O/c1-15-11-17(27(2)3)9-10-20(15)26-21(29)18-13-28(14-19(18)22(23,24)25)12-16-7-5-4-6-8-16/h4-11,18-19H,12-14H2,1-3H3,(H,26,29)/t18-,19+/m1/s1 |
| InChIKey | ZMFPORHBLOOTLD-MOPGFXCFSA-N |
| XLogP | 4.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|