C26H37N5O2 — CID 52624384
2-[3-(4-benzylpiperazin-1-yl)propylcarbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 52624384) has the molecular formula C26H37N5O2 and a molecular weight of 451.62 g/mol. Its IUPAC name is 2-[3-(4-benzylpiperazin-1-yl)propylcarbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[3-(4-benzylpiperazin-1-yl)propylcarbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 52624384 |
| Molecular Formula | C26H37N5O2 |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | 2-[3-(4-benzylpiperazin-1-yl)propylcarbamoylamino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CNC(=O)NCCCN2CCN(Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C26H37N5O2/c1-20-16-21(2)25(22(3)17-20)29-24(32)18-28-26(33)27-10-7-11-30-12-14-31(15-13-30)19-23-8-5-4-6-9-23/h4-6,8-9,16-17H,7,10-15,18-19H2,1-3H3,(H,29,32)(H2,27,28,33) |
| InChIKey | JQGOWXYFXCKBAU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|