C22H29ClN4O3 — CID 22430341
1-(5-chloro-2-methoxyphenyl)-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]urea (PubChem CID 22430341) has the molecular formula C22H29ClN4O3 and a molecular weight of 432.95 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]urea |
|---|---|
| PubChem CID | 22430341 |
| Molecular Formula | C22H29ClN4O3 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]urea |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)Nc3cc(Cl)ccc3OC)CC2)cc1 |
| InChI | InChI=1S/C22H29ClN4O3/c1-29-19-7-5-18(6-8-19)27-14-12-26(13-15-27)11-3-10-24-22(28)25-20-16-17(23)4-9-21(20)30-2/h4-9,16H,3,10-15H2,1-2H3,(H2,24,25,28) |
| InChIKey | WQBUWDVPHOKJOL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|