C28H41ClN4O2 — CID 22911241
1-butyl-3-[5-tert-butyl-2-[3-[4-(4-chlorophenyl)piperazin-1-yl]propoxy]phenyl]urea (PubChem CID 22911241) has the molecular formula C28H41ClN4O2 and a molecular weight of 501.12 g/mol. Its IUPAC name is 1-butyl-3-[5-tert-butyl-2-[3-[4-(4-chlorophenyl)piperazin-1-yl]propoxy]phenyl]urea.
| Compound Name | 1-butyl-3-[5-tert-butyl-2-[3-[4-(4-chlorophenyl)piperazin-1-yl]propoxy]phenyl]urea |
|---|---|
| PubChem CID | 22911241 |
| Molecular Formula | C28H41ClN4O2 |
| Molecular Weight | 501.12 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | 1-butyl-3-[5-tert-butyl-2-[3-[4-(4-chlorophenyl)piperazin-1-yl]propoxy]phenyl]urea |
| SMILES | CCCCNC(=O)Nc1cc(C(C)(C)C)ccc1OCCCN1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C28H41ClN4O2/c1-5-6-14-30-27(34)31-25-21-22(28(2,3)4)8-13-26(25)35-20-7-15-32-16-18-33(19-17-32)24-11-9-23(29)10-12-24/h8-13,21H,5-7,14-20H2,1-4H3,(H2,30,31,34) |
| InChIKey | HPJRIZPVARWPSW-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.12 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|