C19H23N7O — CID 72889458
1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-[3-(2-methylpyrimidin-4-yl)phenyl]urea (PubChem CID 72889458) has the molecular formula C19H23N7O and a molecular weight of 365.44 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-[3-(2-methylpyrimidin-4-yl)phenyl]urea.
| Compound Name | 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-[3-(2-methylpyrimidin-4-yl)phenyl]urea |
|---|---|
| PubChem CID | 72889458 |
| Molecular Formula | C19H23N7O |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1,2,4-triazol-1-yl)propyl]-3-[3-(2-methylpyrimidin-4-yl)phenyl]urea |
| SMILES | Cc1nccc(-c2cccc(NC(=O)NCCCn3nc(C)nc3C)c2)n1 |
| InChI | InChI=1S/C19H23N7O/c1-13-20-10-8-18(23-13)16-6-4-7-17(12-16)24-19(27)21-9-5-11-26-15(3)22-14(2)25-26/h4,6-8,10,12H,5,9,11H2,1-3H3,(H2,21,24,27) |
| InChIKey | QJTCCULMMDRXET-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|