C16H21ClN4O — CID 119707145
2-methyl-3-(methylamino)-N-[3-(2-methylpyrimidin-4-yl)phenyl]propanamide;hydrochloride (PubChem CID 119707145) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-[3-(2-methylpyrimidin-4-yl)phenyl]propanamide;hydrochloride.
| Compound Name | 2-methyl-3-(methylamino)-N-[3-(2-methylpyrimidin-4-yl)phenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119707145 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-[3-(2-methylpyrimidin-4-yl)phenyl]propanamide;hydrochloride |
| SMILES | CNCC(C)C(=O)Nc1cccc(-c2ccnc(C)n2)c1.Cl |
| InChI | InChI=1S/C16H20N4O.ClH/c1-11(10-17-3)16(21)20-14-6-4-5-13(9-14)15-7-8-18-12(2)19-15;/h4-9,11,17H,10H2,1-3H3,(H,20,21);1H |
| InChIKey | KLVRUNWRDCQZIO-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |