C23H25N3O2 — CID 39027894
2-(2-tert-butylphenoxy)-N-[3-(2-methylpyrimidin-4-yl)phenyl]acetamide (PubChem CID 39027894) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-[3-(2-methylpyrimidin-4-yl)phenyl]acetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-[3-(2-methylpyrimidin-4-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 39027894 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-[3-(2-methylpyrimidin-4-yl)phenyl]acetamide |
| SMILES | Cc1nccc(-c2cccc(NC(=O)COc3ccccc3C(C)(C)C)c2)n1 |
| InChI | InChI=1S/C23H25N3O2/c1-16-24-13-12-20(25-16)17-8-7-9-18(14-17)26-22(27)15-28-21-11-6-5-10-19(21)23(2,3)4/h5-14H,15H2,1-4H3,(H,26,27) |
| InChIKey | FGPUXPBPVLEDLU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |