C19H27N5O3S — CID 38103746
N-(3-imidazol-1-ylpropyl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 38103746) has the molecular formula C19H27N5O3S and a molecular weight of 405.52 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 38103746 |
| Molecular Formula | C19H27N5O3S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2cccc(C(=O)NCCCn3ccnc3)c2)CC1 |
| InChI | InChI=1S/C19H27N5O3S/c1-28(26,27)24-12-10-22(11-13-24)15-17-4-2-5-18(14-17)19(25)21-6-3-8-23-9-7-20-16-23/h2,4-5,7,9,14,16H,3,6,8,10-13,15H2,1H3,(H,21,25) |
| InChIKey | FJMNEBUCXIKWMI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 87.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|