C21H31N3O3S — CID 43922830
N-[2-(cyclohexen-1-yl)ethyl]-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide (PubChem CID 43922830) has the molecular formula C21H31N3O3S and a molecular weight of 405.56 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
|---|---|
| PubChem CID | 43922830 |
| Molecular Formula | C21H31N3O3S |
| Molecular Weight | 405.56 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[(4-methylsulfonylpiperazin-1-yl)methyl]benzamide |
| SMILES | CS(=O)(=O)N1CCN(Cc2cccc(C(=O)NCCC3=CCCCC3)c2)CC1 |
| InChI | InChI=1S/C21H31N3O3S/c1-28(26,27)24-14-12-23(13-15-24)17-19-8-5-9-20(16-19)21(25)22-11-10-18-6-3-2-4-7-18/h5-6,8-9,16H,2-4,7,10-15,17H2,1H3,(H,22,25) |
| InChIKey | VGGULRRFUSIQDN-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|