C21H24N4O2S — CID 11856616
N-[(1S)-2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]butanamide (PubChem CID 11856616) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is N-[(1S)-2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]butanamide.
| Compound Name | N-[(1S)-2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]butanamide |
|---|---|
| PubChem CID | 11856616 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[(1S)-2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]butanamide |
| SMILES | CCCC(=O)N[C@H](C(=O)NCCNc1nsc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-2-8-18(26)24-19(15-9-4-3-5-10-15)21(27)23-14-13-22-20-16-11-6-7-12-17(16)28-25-20/h3-7,9-12,19H,2,8,13-14H2,1H3,(H,22,25)(H,23,27)(H,24,26)/t19-/m0/s1 |
| InChIKey | RKICUHCRQOCWFZ-IBGZPJMESA-N |
| XLogP | 3.48 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|