C27H31ClN4O2S — CID 143285641
(Z)-N-[2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]-2-methylidenehex-3-enamide;(E)-1-chloroprop-1-ene (PubChem CID 143285641) has the molecular formula C27H31ClN4O2S and a molecular weight of 511.09 g/mol. Its IUPAC name is (Z)-N-[2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]-2-methylidenehex-3-enamide;(E)-1-chloroprop-1-ene.
| Compound Name | (Z)-N-[2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]-2-methylidenehex-3-enamide;(E)-1-chloroprop-1-ene |
|---|---|
| PubChem CID | 143285641 |
| Molecular Formula | C27H31ClN4O2S |
| Molecular Weight | 511.09 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | (Z)-N-[2-[2-(1,2-benzothiazol-3-ylamino)ethylamino]-2-oxo-1-phenylethyl]-2-methylidenehex-3-enamide;(E)-1-chloroprop-1-ene |
| SMILES | C/C=C/Cl.C=C(/C=C\CC)C(=O)NC(C(=O)NCCNc1nsc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C24H26N4O2S.C3H5Cl/c1-3-4-10-17(2)23(29)27-21(18-11-6-5-7-12-18)24(30)26-16-15-25-22-19-13-8-9-14-20(19)31-28-22;1-2-3-4/h4-14,21H,2-3,15-16H2,1H3,(H,25,28)(H,26,30)(H,27,29);2-3H,1H3/b10-4-;3-2+ |
| InChIKey | ATNKLUMVCKYRPK-HYGPFSIISA-N |
| XLogP | 5.96 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.09 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|