About N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide
N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide (PubChem CID 87461413) has the molecular formula C19H22N4O3S
and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide.
Molecular Properties
| Compound Name | N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide |
| PubChem CID | 87461413 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide |
| SMILES | CC(c1ccccc1)[N+]([O-])(NCCCNc1nsc2ccccc12)C(=O)O |
| InChI | InChI=1S/C19H22N4O3S/c1-14(15-8-3-2-4-9-15)23(26,19(24)25)21-13-7-12-20-18-16-10-5-6-11-17(16)27-22-18/h2-6,8-11,14,21H,7,12-13H2,1H3,(H,20,22)(H,24,25) |
| InChIKey | WUCROYZMORKALA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide?
The IUPAC name of N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide (CID 87461413) is N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide.
What is the SMILES notation for N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide?
The canonical SMILES for N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide is CC(c1ccccc1)[N+]([O-])(NCCCNc1nsc2ccccc12)C(=O)O.
What is the InChIKey of N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide?
The InChIKey is WUCROYZMORKALA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O3S/c1-14(15-8-3-2-4-9-15)23(26,19(24)25)21-13-7-12-20-18-16-10-5-6-11-17(16)27-22-18/h2-6,8-11,14,21H,7,12-13H2,1H3,(H,20,22)(H,24,25).
What are the key properties of N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide?
N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide has a molecular weight of 386.48 g/mol, XLogP of 4.36, 8 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(1,2-benzothiazol-3-ylamino)propylamino]-N-carboxy-1-phenylethanamine oxide is sourced from PubChem (CID 87461413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).