C9H5FN4O3S — CID 55103700
3-fluoro-4-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 55103700) has the molecular formula C9H5FN4O3S and a molecular weight of 268.23 g/mol. Its IUPAC name is 3-fluoro-4-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-fluoro-4-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 55103700 |
| Molecular Formula | C9H5FN4O3S |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 3-fluoro-4-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nncs1)c1ccc([N+](=O)[O-])c(F)c1 |
| InChI | InChI=1S/C9H5FN4O3S/c10-6-3-5(1-2-7(6)14(16)17)8(15)12-9-13-11-4-18-9/h1-4H,(H,12,13,15) |
| InChIKey | PPVIJWJGXQNBLK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|