C9H6N4O4S — CID 29370606
3-hydroxy-4-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 29370606) has the molecular formula C9H6N4O4S and a molecular weight of 266.24 g/mol. Its IUPAC name is 3-hydroxy-4-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3-hydroxy-4-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 29370606 |
| Molecular Formula | C9H6N4O4S |
| Molecular Weight | 266.24 g/mol |
| Exact Mass | 266.01 |
| IUPAC Name | 3-hydroxy-4-nitro-N-(1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nncs1)c1ccc([N+](=O)[O-])c(O)c1 |
| InChI | InChI=1S/C9H6N4O4S/c14-7-3-5(1-2-6(7)13(16)17)8(15)11-9-12-10-4-18-9/h1-4,14H,(H,11,12,15) |
| InChIKey | GPWDAEUZEQRYCG-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|