C16H11N5O6S — CID 141181390
[4-[2-nitro-4-(1,3,4-thiadiazol-2-ylcarbamoyl)phenoxy]phenyl]carbamic acid (PubChem CID 141181390) has the molecular formula C16H11N5O6S and a molecular weight of 401.36 g/mol. Its IUPAC name is [4-[2-nitro-4-(1,3,4-thiadiazol-2-ylcarbamoyl)phenoxy]phenyl]carbamic acid.
| Compound Name | [4-[2-nitro-4-(1,3,4-thiadiazol-2-ylcarbamoyl)phenoxy]phenyl]carbamic acid |
|---|---|
| PubChem CID | 141181390 |
| Molecular Formula | C16H11N5O6S |
| Molecular Weight | 401.36 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | [4-[2-nitro-4-(1,3,4-thiadiazol-2-ylcarbamoyl)phenoxy]phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(Oc2ccc(C(=O)Nc3nncs3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H11N5O6S/c22-14(19-15-20-17-8-28-15)9-1-6-13(12(7-9)21(25)26)27-11-4-2-10(3-5-11)18-16(23)24/h1-8,18H,(H,23,24)(H,19,20,22) |
| InChIKey | LVDMEWRKPYJIPI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 156.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.36 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|