C13H14N6O3 — CID 26120620
4-amino-N'-(4,6-dimethylpyrimidin-2-yl)-3-nitrobenzohydrazide (PubChem CID 26120620) has the molecular formula C13H14N6O3 and a molecular weight of 302.29 g/mol. Its IUPAC name is 4-amino-N'-(4,6-dimethylpyrimidin-2-yl)-3-nitrobenzohydrazide.
| Compound Name | 4-amino-N'-(4,6-dimethylpyrimidin-2-yl)-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 26120620 |
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.29 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | 4-amino-N'-(4,6-dimethylpyrimidin-2-yl)-3-nitrobenzohydrazide |
| SMILES | Cc1cc(C)nc(NNC(=O)c2ccc(N)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C13H14N6O3/c1-7-5-8(2)16-13(15-7)18-17-12(20)9-3-4-10(14)11(6-9)19(21)22/h3-6H,14H2,1-2H3,(H,17,20)(H,15,16,18) |
| InChIKey | PUMSKBRNJGVMCD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|