C18H15N5O5S2 — CID 4626175
N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[(4-nitrophenyl)sulfamoyl]benzamide (PubChem CID 4626175) has the molecular formula C18H15N5O5S2 and a molecular weight of 445.48 g/mol. Its IUPAC name is N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[(4-nitrophenyl)sulfamoyl]benzamide.
| Compound Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[(4-nitrophenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 4626175 |
| Molecular Formula | C18H15N5O5S2 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | N-(5-cyclopropyl-1,3,4-thiadiazol-2-yl)-3-[(4-nitrophenyl)sulfamoyl]benzamide |
| SMILES | O=C(Nc1nnc(C2CC2)s1)c1cccc(S(=O)(=O)Nc2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C18H15N5O5S2/c24-16(19-18-21-20-17(29-18)11-4-5-11)12-2-1-3-15(10-12)30(27,28)22-13-6-8-14(9-7-13)23(25)26/h1-3,6-11,22H,4-5H2,(H,19,21,24) |
| InChIKey | MDXYOLTVBKGALG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 144.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|